C34H44O3P+ — CID 11262335
10-(4-methyl-2,6,7-trioxabicyclo[2.2.2]octan-1-yl)decyl-triphenylphosphanium (PubChem CID 11262335) has the molecular formula C34H44O3P+ and a molecular weight of 531.70 g/mol. Its IUPAC name is 10-(4-methyl-2,6,7-trioxabicyclo[2.2.2]octan-1-yl)decyl-triphenylphosphanium.
| Compound Name | 10-(4-methyl-2,6,7-trioxabicyclo[2.2.2]octan-1-yl)decyl-triphenylphosphanium |
|---|---|
| PubChem CID | 11262335 |
| Molecular Formula | C34H44O3P+ |
| Molecular Weight | 531.70 g/mol |
| Exact Mass | 531.30 |
| IUPAC Name | 10-(4-methyl-2,6,7-trioxabicyclo[2.2.2]octan-1-yl)decyl-triphenylphosphanium |
| SMILES | CC12COC(CCCCCCCCCC[P+](c3ccccc3)(c3ccccc3)c3ccccc3)(OC1)OC2 |
| InChI | InChI=1S/C34H44O3P/c1-33-27-35-34(36-28-33,37-29-33)25-17-6-4-2-3-5-7-18-26-38(30-19-11-8-12-20-30,31-21-13-9-14-22-31)32-23-15-10-16-24-32/h8-16,19-24H,2-7,17-18,25-29H2,1H3/q+1 |
| InChIKey | QOFUKYORZMOPDF-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.70 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|