C39H48OP+ — CID 138474373
7-(2,5,6,7,8-pentamethyl-3,4-dihydrochromen-2-yl)heptyl-triphenylphosphanium (PubChem CID 138474373) has the molecular formula C39H48OP+ and a molecular weight of 563.79 g/mol. Its IUPAC name is 7-(2,5,6,7,8-pentamethyl-3,4-dihydrochromen-2-yl)heptyl-triphenylphosphanium.
| Compound Name | 7-(2,5,6,7,8-pentamethyl-3,4-dihydrochromen-2-yl)heptyl-triphenylphosphanium |
|---|---|
| PubChem CID | 138474373 |
| Molecular Formula | C39H48OP+ |
| Molecular Weight | 563.79 g/mol |
| Exact Mass | 563.34 |
| IUPAC Name | 7-(2,5,6,7,8-pentamethyl-3,4-dihydrochromen-2-yl)heptyl-triphenylphosphanium |
| SMILES | Cc1c(C)c(C)c2c(c1C)CCC(C)(CCCCCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1)O2 |
| InChI | InChI=1S/C39H48OP/c1-30-31(2)33(4)38-37(32(30)3)26-28-39(5,40-38)27-18-7-6-8-19-29-41(34-20-12-9-13-21-34,35-22-14-10-15-23-35)36-24-16-11-17-25-36/h9-17,20-25H,6-8,18-19,26-29H2,1-5H3/q+1 |
| InChIKey | LWIXNCPQZCEQHN-UHFFFAOYSA-N |
| XLogP | 9.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.79 |
| LogP ≤ 5 | 9.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|