C33H60O — CID 142957328
(2R)-2-[(8S)-8,12-dimethyltridecyl]-2,5,7,8-tetramethyl-6-propan-2-yl-3,4-dihydrochromene;ethane (PubChem CID 142957328) has the molecular formula C33H60O and a molecular weight of 472.84 g/mol. Its IUPAC name is (2R)-2-[(8S)-8,12-dimethyltridecyl]-2,5,7,8-tetramethyl-6-propan-2-yl-3,4-dihydrochromene;ethane.
| Compound Name | (2R)-2-[(8S)-8,12-dimethyltridecyl]-2,5,7,8-tetramethyl-6-propan-2-yl-3,4-dihydrochromene;ethane |
|---|---|
| PubChem CID | 142957328 |
| Molecular Formula | C33H60O |
| Molecular Weight | 472.84 g/mol |
| Exact Mass | 472.46 |
| IUPAC Name | (2R)-2-[(8S)-8,12-dimethyltridecyl]-2,5,7,8-tetramethyl-6-propan-2-yl-3,4-dihydrochromene;ethane |
| SMILES | CC.Cc1c(C)c(C(C)C)c(C)c2c1O[C@](C)(CCCCCCC[C@H](C)CCCC(C)C)CC2 |
| InChI | InChI=1S/C31H54O.C2H6/c1-22(2)16-15-18-24(5)17-13-11-10-12-14-20-31(9)21-19-28-27(8)29(23(3)4)25(6)26(7)30(28)32-31;1-2/h22-24H,10-21H2,1-9H3;1-2H3/t24-,31+;/m0./s1 |
| InChIKey | DOSUEJLTUMGJDN-UXKOITPWSA-N |
| XLogP | 11.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.84 |
| LogP ≤ 5 | 11.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|