C41H52IO2P — CID 172681428
10-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)decyl-triphenylphosphanium iodide (PubChem CID 172681428) has the molecular formula C41H52IO2P and a molecular weight of 734.74 g/mol. Its IUPAC name is 10-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)decyl-triphenylphosphanium iodide.
| Compound Name | 10-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)decyl-triphenylphosphanium iodide |
|---|---|
| PubChem CID | 172681428 |
| Molecular Formula | C41H52IO2P |
| Molecular Weight | 734.74 g/mol |
| Exact Mass | 734.27 |
| IUPAC Name | 10-(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)decyl-triphenylphosphanium iodide |
| SMILES | Cc1c(C)c2c(c(C)c1O)CCC(C)(CCCCCCCCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1)O2.[I-] |
| InChI | InChI=1S/C41H51O2P.HI/c1-32-33(2)40-38(34(3)39(32)42)28-30-41(4,43-40)29-20-9-7-5-6-8-10-21-31-44(35-22-14-11-15-23-35,36-24-16-12-17-25-36)37-26-18-13-19-27-37;/h11-19,22-27H,5-10,20-21,28-31H2,1-4H3;1H |
| InChIKey | ALLBQBWNAIXVMB-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.74 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|