C35H44O2P+ — CID 122581135
10-(3,6-dihydroxy-4-methylcyclohexa-1,4-dien-1-yl)decyl-triphenylphosphanium (PubChem CID 122581135) has the molecular formula C35H44O2P+ and a molecular weight of 527.71 g/mol. Its IUPAC name is 10-(3,6-dihydroxy-4-methylcyclohexa-1,4-dien-1-yl)decyl-triphenylphosphanium.
| Compound Name | 10-(3,6-dihydroxy-4-methylcyclohexa-1,4-dien-1-yl)decyl-triphenylphosphanium |
|---|---|
| PubChem CID | 122581135 |
| Molecular Formula | C35H44O2P+ |
| Molecular Weight | 527.71 g/mol |
| Exact Mass | 527.31 |
| IUPAC Name | 10-(3,6-dihydroxy-4-methylcyclohexa-1,4-dien-1-yl)decyl-triphenylphosphanium |
| SMILES | CC1=CC(O)C(CCCCCCCCCC[P+](c2ccccc2)(c2ccccc2)c2ccccc2)=CC1O |
| InChI | InChI=1S/C35H44O2P/c1-29-27-35(37)30(28-34(29)36)19-11-6-4-2-3-5-7-18-26-38(31-20-12-8-13-21-31,32-22-14-9-15-23-32)33-24-16-10-17-25-33/h8-10,12-17,20-25,27-28,34-37H,2-7,11,18-19,26H2,1H3/q+1 |
| InChIKey | XSOOCSRNUHINKI-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.71 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|