C30H34IO3P — CID 169074604
[(Z)-6-(4-methyl-2,6,7-trioxabicyclo[2.2.2]octan-1-yl)hex-3-enyl]iodanuidyl-triphenylphosphanium (PubChem CID 169074604) has the molecular formula C30H34IO3P and a molecular weight of 600.48 g/mol. Its IUPAC name is [(Z)-6-(4-methyl-2,6,7-trioxabicyclo[2.2.2]octan-1-yl)hex-3-enyl]iodanuidyl-triphenylphosphanium.
| Compound Name | [(Z)-6-(4-methyl-2,6,7-trioxabicyclo[2.2.2]octan-1-yl)hex-3-enyl]iodanuidyl-triphenylphosphanium |
|---|---|
| PubChem CID | 169074604 |
| Molecular Formula | C30H34IO3P |
| Molecular Weight | 600.48 g/mol |
| Exact Mass | 600.13 |
| IUPAC Name | [(Z)-6-(4-methyl-2,6,7-trioxabicyclo[2.2.2]octan-1-yl)hex-3-enyl]iodanuidyl-triphenylphosphanium |
| SMILES | CC12COC(CC/C=C\CC[I-][P+](c3ccccc3)(c3ccccc3)c3ccccc3)(OC1)OC2 |
| InChI | InChI=1S/C30H34IO3P/c1-29-23-32-30(33-24-29,34-25-29)21-13-2-3-14-22-31-35(26-15-7-4-8-16-26,27-17-9-5-10-18-27)28-19-11-6-12-20-28/h2-12,15-20H,13-14,21-25H2,1H3/b3-2- |
| InChIKey | ZFDWPXQBADPMFB-IHWYPQMZSA-N |
| XLogP | 2.45 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.48 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|