C31H40IO2P — CID 165377052
[(Z)-11,11-dimethoxyundec-4-enyl]iodanuidyl-triphenylphosphanium (PubChem CID 165377052) has the molecular formula C31H40IO2P and a molecular weight of 602.54 g/mol. Its IUPAC name is [(Z)-11,11-dimethoxyundec-4-enyl]iodanuidyl-triphenylphosphanium.
| Compound Name | [(Z)-11,11-dimethoxyundec-4-enyl]iodanuidyl-triphenylphosphanium |
|---|---|
| PubChem CID | 165377052 |
| Molecular Formula | C31H40IO2P |
| Molecular Weight | 602.54 g/mol |
| Exact Mass | 602.18 |
| IUPAC Name | [(Z)-11,11-dimethoxyundec-4-enyl]iodanuidyl-triphenylphosphanium |
| SMILES | COC(CCCCC/C=C\CCC[I-][P+](c1ccccc1)(c1ccccc1)c1ccccc1)OC |
| InChI | InChI=1S/C31H40IO2P/c1-33-31(34-2)26-18-7-5-3-4-6-8-19-27-32-35(28-20-12-9-13-21-28,29-22-14-10-15-23-29)30-24-16-11-17-25-30/h4,6,9-17,20-25,31H,3,5,7-8,18-19,26-27H2,1-2H3/b6-4- |
| InChIKey | SKAOWYKOCNSNJM-XQRVVYSFSA-N |
| XLogP | 3.89 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.54 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|