C43H64ClO2P — CID 175312709
11,11-diheptoxyundec-4-enyl(triphenyl)phosphanium chloride (PubChem CID 175312709) has the molecular formula C43H64ClO2P and a molecular weight of 679.41 g/mol. Its IUPAC name is 11,11-diheptoxyundec-4-enyl(triphenyl)phosphanium chloride.
| Compound Name | 11,11-diheptoxyundec-4-enyl(triphenyl)phosphanium chloride |
|---|---|
| PubChem CID | 175312709 |
| Molecular Formula | C43H64ClO2P |
| Molecular Weight | 679.41 g/mol |
| Exact Mass | 678.43 |
| IUPAC Name | 11,11-diheptoxyundec-4-enyl(triphenyl)phosphanium chloride |
| SMILES | CCCCCCCOC(CCCCCC=CCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1)OCCCCCCC.[Cl-] |
| InChI | InChI=1S/C43H64O2P.ClH/c1-3-5-7-14-27-37-44-43(45-38-28-15-8-6-4-2)36-26-13-11-9-10-12-16-29-39-46(40-30-20-17-21-31-40,41-32-22-18-23-33-41)42-34-24-19-25-35-42;/h10,12,17-25,30-35,43H,3-9,11,13-16,26-29,36-39H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | GHKXHTKMUDLPLF-UHFFFAOYSA-M |
| XLogP | 8.57 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.41 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|