C43H63ClO2P+ — CID 165174869
chloro-[4-[(Z)-11,11-diheptoxyundec-4-enyl]phenyl]-diphenylphosphanium (PubChem CID 165174869) has the molecular formula C43H63ClO2P+ and a molecular weight of 678.40 g/mol. Its IUPAC name is chloro-[4-[(Z)-11,11-diheptoxyundec-4-enyl]phenyl]-diphenylphosphanium.
| Compound Name | chloro-[4-[(Z)-11,11-diheptoxyundec-4-enyl]phenyl]-diphenylphosphanium |
|---|---|
| PubChem CID | 165174869 |
| Molecular Formula | C43H63ClO2P+ |
| Molecular Weight | 678.40 g/mol |
| Exact Mass | 677.42 |
| IUPAC Name | chloro-[4-[(Z)-11,11-diheptoxyundec-4-enyl]phenyl]-diphenylphosphanium |
| SMILES | CCCCCCCOC(CCCCC/C=C\CCCc1ccc([P+](Cl)(c2ccccc2)c2ccccc2)cc1)OCCCCCCC |
| InChI | InChI=1S/C43H63ClO2P/c1-3-5-7-15-25-37-45-43(46-38-26-16-8-6-4-2)32-24-14-12-10-9-11-13-19-27-39-33-35-42(36-34-39)47(44,40-28-20-17-21-29-40)41-30-22-18-23-31-41/h9,11,17-18,20-23,28-31,33-36,43H,3-8,10,12-16,19,24-27,32,37-38H2,1-2H3/q+1/b11-9- |
| InChIKey | VNXYKBZKKBWHHP-LUAWRHEFSA-N |
| XLogP | 12.26 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.40 |
| LogP ≤ 5 | 12.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|