C31H39IO2P+ — CID 165175065
[4-[(Z)-11,11-dimethoxyundec-4-enyl]phenyl]-iodo-diphenylphosphanium (PubChem CID 165175065) has the molecular formula C31H39IO2P+ and a molecular weight of 601.53 g/mol. Its IUPAC name is [4-[(Z)-11,11-dimethoxyundec-4-enyl]phenyl]-iodo-diphenylphosphanium.
| Compound Name | [4-[(Z)-11,11-dimethoxyundec-4-enyl]phenyl]-iodo-diphenylphosphanium |
|---|---|
| PubChem CID | 165175065 |
| Molecular Formula | C31H39IO2P+ |
| Molecular Weight | 601.53 g/mol |
| Exact Mass | 601.17 |
| IUPAC Name | [4-[(Z)-11,11-dimethoxyundec-4-enyl]phenyl]-iodo-diphenylphosphanium |
| SMILES | COC(CCCCC/C=C\CCCc1ccc([P+](I)(c2ccccc2)c2ccccc2)cc1)OC |
| InChI | InChI=1S/C31H39IO2P/c1-33-31(34-2)22-16-8-6-4-3-5-7-11-17-27-23-25-30(26-24-27)35(32,28-18-12-9-13-19-28)29-20-14-10-15-21-29/h3,5,9-10,12-15,18-21,23-26,31H,4,6-8,11,16-17,22H2,1-2H3/q+1/b5-3- |
| InChIKey | VSYVONHKRHXKQE-HYXAFXHYSA-N |
| XLogP | 7.78 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.53 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|