C35H48ClO2P — CID 175312685
[(Z)-11,11-dipropoxyundec-4-enyl]-triphenylphosphanium chloride (PubChem CID 175312685) has the molecular formula C35H48ClO2P and a molecular weight of 567.19 g/mol. Its IUPAC name is [(Z)-11,11-dipropoxyundec-4-enyl]-triphenylphosphanium chloride.
| Compound Name | [(Z)-11,11-dipropoxyundec-4-enyl]-triphenylphosphanium chloride |
|---|---|
| PubChem CID | 175312685 |
| Molecular Formula | C35H48ClO2P |
| Molecular Weight | 567.19 g/mol |
| Exact Mass | 566.31 |
| IUPAC Name | [(Z)-11,11-dipropoxyundec-4-enyl]-triphenylphosphanium chloride |
| SMILES | CCCOC(CCCCC/C=C\CCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1)OCCC.[Cl-] |
| InChI | InChI=1S/C35H48O2P.ClH/c1-3-29-36-35(37-30-4-2)28-20-9-7-5-6-8-10-21-31-38(32-22-14-11-15-23-32,33-24-16-12-17-25-33)34-26-18-13-19-27-34;/h6,8,11-19,22-27,35H,3-5,7,9-10,20-21,28-31H2,1-2H3;1H/q+1;/p-1/b8-6-; |
| InChIKey | NASWGKVJTLWRJO-PHZXCRFESA-M |
| XLogP | 5.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.19 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|