C24H34O5S — CID 143310808
1-[(Z)-6-[(1R)-2-(benzenesulfonylmethyl)cyclopentyl]hex-4-enyl]-4-methyl-2,6,7-trioxabicyclo[2.2.2]octane (PubChem CID 143310808) has the molecular formula C24H34O5S and a molecular weight of 434.60 g/mol. Its IUPAC name is 1-[(Z)-6-[(1R)-2-(benzenesulfonylmethyl)cyclopentyl]hex-4-enyl]-4-methyl-2,6,7-trioxabicyclo[2.2.2]octane.
| Compound Name | 1-[(Z)-6-[(1R)-2-(benzenesulfonylmethyl)cyclopentyl]hex-4-enyl]-4-methyl-2,6,7-trioxabicyclo[2.2.2]octane |
|---|---|
| PubChem CID | 143310808 |
| Molecular Formula | C24H34O5S |
| Molecular Weight | 434.60 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | 1-[(Z)-6-[(1R)-2-(benzenesulfonylmethyl)cyclopentyl]hex-4-enyl]-4-methyl-2,6,7-trioxabicyclo[2.2.2]octane |
| SMILES | CC12COC(CCC/C=C\C[C@H]3CCCC3CS(=O)(=O)c3ccccc3)(OC1)OC2 |
| InChI | InChI=1S/C24H34O5S/c1-23-17-27-24(28-18-23,29-19-23)15-8-3-2-5-10-20-11-9-12-21(20)16-30(25,26)22-13-6-4-7-14-22/h2,4-7,13-14,20-21H,3,8-12,15-19H2,1H3/b5-2-/t20-,21?,23?,24?/m0/s1 |
| InChIKey | SLLGRHBPNUSNGG-TVANOIAFSA-N |
| XLogP | 4.73 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.60 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|