C20H28O5S — CID 146294528
4-[[(2S,5S)-4-(benzenesulfonylmethyl)-5-prop-2-enyloxolan-2-yl]methyl]-2,2-dimethyl-1,3-dioxolane (PubChem CID 146294528) has the molecular formula C20H28O5S and a molecular weight of 380.51 g/mol. Its IUPAC name is 4-[[(2S,5S)-4-(benzenesulfonylmethyl)-5-prop-2-enyloxolan-2-yl]methyl]-2,2-dimethyl-1,3-dioxolane.
| Compound Name | 4-[[(2S,5S)-4-(benzenesulfonylmethyl)-5-prop-2-enyloxolan-2-yl]methyl]-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 146294528 |
| Molecular Formula | C20H28O5S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 4-[[(2S,5S)-4-(benzenesulfonylmethyl)-5-prop-2-enyloxolan-2-yl]methyl]-2,2-dimethyl-1,3-dioxolane |
| SMILES | C=CC[C@@H]1O[C@H](CC2COC(C)(C)O2)CC1CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H28O5S/c1-4-8-19-15(14-26(21,22)18-9-6-5-7-10-18)11-16(24-19)12-17-13-23-20(2,3)25-17/h4-7,9-10,15-17,19H,1,8,11-14H2,2-3H3/t15?,16-,17?,19-/m0/s1 |
| InChIKey | DMVQHSHRLKWAMO-OLECLDRESA-N |
| XLogP | 3.35 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|