C29H42O8S — CID 130359020
3-[(2S,4R,6S)-6-[[(2S,3S,4R,5R)-3-(benzenesulfonylmethyl)-5-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-4-methoxyoxolan-2-yl]methyl]-4-methyl-5-methylideneoxan-2-yl]propanal (PubChem CID 130359020) has the molecular formula C29H42O8S and a molecular weight of 550.71 g/mol. Its IUPAC name is 3-[(2S,4R,6S)-6-[[(2S,3S,4R,5R)-3-(benzenesulfonylmethyl)-5-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-4-methoxyoxolan-2-yl]methyl]-4-methyl-5-methylideneoxan-2-yl]propanal.
| Compound Name | 3-[(2S,4R,6S)-6-[[(2S,3S,4R,5R)-3-(benzenesulfonylmethyl)-5-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-4-methoxyoxolan-2-yl]methyl]-4-methyl-5-methylideneoxan-2-yl]propanal |
|---|---|
| PubChem CID | 130359020 |
| Molecular Formula | C29H42O8S |
| Molecular Weight | 550.71 g/mol |
| Exact Mass | 550.26 |
| IUPAC Name | 3-[(2S,4R,6S)-6-[[(2S,3S,4R,5R)-3-(benzenesulfonylmethyl)-5-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-4-methoxyoxolan-2-yl]methyl]-4-methyl-5-methylideneoxan-2-yl]propanal |
| SMILES | C=C1[C@H](C)C[C@H](CCC=O)O[C@H]1C[C@@H]1O[C@H](C[C@H]2COC(C)(C)O2)[C@H](OC)[C@H]1CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C29H42O8S/c1-19-14-21(10-9-13-30)35-25(20(19)2)16-26-24(18-38(31,32)23-11-7-6-8-12-23)28(33-5)27(36-26)15-22-17-34-29(3,4)37-22/h6-8,11-13,19,21-22,24-28H,2,9-10,14-18H2,1,3-5H3/t19-,21+,22+,24+,25+,26+,27-,28-/m1/s1 |
| InChIKey | JMMAPODZSQJZPS-BXTDDMJSSA-N |
| XLogP | 4.12 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.71 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|