C31H48O9S — CID 118056812
3-[6-[[(2S,4R,5R)-3-(benzenesulfonylmethyl)-5-(2,3-dihydroxypropyl)-4-methoxyoxolan-2-yl]methyl]-4-methyl-5-methylideneoxan-2-yl]propyl 2,2-dimethylpropanoate (PubChem CID 118056812) has the molecular formula C31H48O9S and a molecular weight of 596.78 g/mol. Its IUPAC name is 3-[6-[[(2S,4R,5R)-3-(benzenesulfonylmethyl)-5-(2,3-dihydroxypropyl)-4-methoxyoxolan-2-yl]methyl]-4-methyl-5-methylideneoxan-2-yl]propyl 2,2-dimethylpropanoate.
| Compound Name | 3-[6-[[(2S,4R,5R)-3-(benzenesulfonylmethyl)-5-(2,3-dihydroxypropyl)-4-methoxyoxolan-2-yl]methyl]-4-methyl-5-methylideneoxan-2-yl]propyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 118056812 |
| Molecular Formula | C31H48O9S |
| Molecular Weight | 596.78 g/mol |
| Exact Mass | 596.30 |
| IUPAC Name | 3-[6-[[(2S,4R,5R)-3-(benzenesulfonylmethyl)-5-(2,3-dihydroxypropyl)-4-methoxyoxolan-2-yl]methyl]-4-methyl-5-methylideneoxan-2-yl]propyl 2,2-dimethylpropanoate |
| SMILES | C=C1C(C)CC(CCCOC(=O)C(C)(C)C)OC1C[C@@H]1O[C@H](CC(O)CO)[C@H](OC)C1CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C31H48O9S/c1-20-15-23(11-10-14-38-30(34)31(3,4)5)39-26(21(20)2)17-27-25(19-41(35,36)24-12-8-7-9-13-24)29(37-6)28(40-27)16-22(33)18-32/h7-9,12-13,20,22-23,25-29,32-33H,2,10-11,14-19H2,1,3-6H3/t20?,22?,23?,25?,26?,27-,28+,29+/m0/s1 |
| InChIKey | JNYCKADNBAFHDB-INLARBTRSA-N |
| XLogP | 3.71 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.78 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|