C27H46O7S — CID 88927902
3-[(2R,3R,5S)-5-[[(4R,6S)-6-[2-[(2S)-5-(3-hydroxypropyl)-3-methylideneoxolan-2-yl]ethyl]-4-methyl-3-methylideneoxan-2-yl]methyl]-3-methoxy-4-(sulfanylmethyl)oxolan-2-yl]propane-1,2-diol (PubChem CID 88927902) has the molecular formula C27H46O7S and a molecular weight of 514.73 g/mol. Its IUPAC name is 3-[(2R,3R,5S)-5-[[(4R,6S)-6-[2-[(2S)-5-(3-hydroxypropyl)-3-methylideneoxolan-2-yl]ethyl]-4-methyl-3-methylideneoxan-2-yl]methyl]-3-methoxy-4-(sulfanylmethyl)oxolan-2-yl]propane-1,2-diol.
| Compound Name | 3-[(2R,3R,5S)-5-[[(4R,6S)-6-[2-[(2S)-5-(3-hydroxypropyl)-3-methylideneoxolan-2-yl]ethyl]-4-methyl-3-methylideneoxan-2-yl]methyl]-3-methoxy-4-(sulfanylmethyl)oxolan-2-yl]propane-1,2-diol |
|---|---|
| PubChem CID | 88927902 |
| Molecular Formula | C27H46O7S |
| Molecular Weight | 514.73 g/mol |
| Exact Mass | 514.30 |
| IUPAC Name | 3-[(2R,3R,5S)-5-[[(4R,6S)-6-[2-[(2S)-5-(3-hydroxypropyl)-3-methylideneoxolan-2-yl]ethyl]-4-methyl-3-methylideneoxan-2-yl]methyl]-3-methoxy-4-(sulfanylmethyl)oxolan-2-yl]propane-1,2-diol |
| SMILES | C=C1C(C[C@@H]2O[C@H](CC(O)CO)[C@H](OC)C2CS)O[C@@H](CC[C@@H]2OC(CCCO)CC2=C)C[C@H]1C |
| InChI | InChI=1S/C27H46O7S/c1-16-10-21(7-8-23-17(2)11-20(32-23)6-5-9-28)33-24(18(16)3)13-25-22(15-35)27(31-4)26(34-25)12-19(30)14-29/h16,19-30,35H,2-3,5-15H2,1,4H3/t16-,19?,20?,21+,22?,23+,24?,25+,26-,27-/m1/s1 |
| InChIKey | UOHFSHUQSACZGK-KWZJDIEDSA-N |
| XLogP | 3.06 |
| TPSA | 97.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.73 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|