C37H52BrO2P — CID 10963277
7-(2-hexyl-5,5-dimethyl-1,3-dioxan-2-yl)heptyl-triphenylphosphanium bromide (PubChem CID 10963277) has the molecular formula C37H52BrO2P and a molecular weight of 639.70 g/mol. Its IUPAC name is 7-(2-hexyl-5,5-dimethyl-1,3-dioxan-2-yl)heptyl-triphenylphosphanium bromide.
| Compound Name | 7-(2-hexyl-5,5-dimethyl-1,3-dioxan-2-yl)heptyl-triphenylphosphanium bromide |
|---|---|
| PubChem CID | 10963277 |
| Molecular Formula | C37H52BrO2P |
| Molecular Weight | 639.70 g/mol |
| Exact Mass | 638.29 |
| IUPAC Name | 7-(2-hexyl-5,5-dimethyl-1,3-dioxan-2-yl)heptyl-triphenylphosphanium bromide |
| SMILES | CCCCCCC1(CCCCCCC[P+](c2ccccc2)(c2ccccc2)c2ccccc2)OCC(C)(C)CO1.[Br-] |
| InChI | InChI=1S/C37H52O2P.BrH/c1-4-5-6-19-28-37(38-31-36(2,3)32-39-37)29-20-8-7-9-21-30-40(33-22-13-10-14-23-33,34-24-15-11-16-25-34)35-26-17-12-18-27-35;/h10-18,22-27H,4-9,19-21,28-32H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | QMSHFLBGJQAYBY-UHFFFAOYSA-M |
| XLogP | 6.06 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.70 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|