C21H18O4 — CID 177450282
(1R,7R,9S,11S)-1,11-diphenyl-8,10,12,13-tetraoxapentacyclo[5.5.1.02,6.03,11.04,9]tridecane (PubChem CID 177450282) has the molecular formula C21H18O4 and a molecular weight of 334.37 g/mol. Its IUPAC name is (1R,7R,9S,11S)-1,11-diphenyl-8,10,12,13-tetraoxapentacyclo[5.5.1.02,6.03,11.04,9]tridecane.
| Compound Name | (1R,7R,9S,11S)-1,11-diphenyl-8,10,12,13-tetraoxapentacyclo[5.5.1.02,6.03,11.04,9]tridecane |
|---|---|
| PubChem CID | 177450282 |
| Molecular Formula | C21H18O4 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | (1R,7R,9S,11S)-1,11-diphenyl-8,10,12,13-tetraoxapentacyclo[5.5.1.02,6.03,11.04,9]tridecane |
| SMILES | c1ccc([C@]23O[C@H]4O[C@H]5O[C@](c6ccccc6)(O2)C2C5CC4C23)cc1 |
| InChI | InChI=1S/C21H18O4/c1-3-7-12(8-4-1)20-16-14-11-15-17(16)21(25-20,13-9-5-2-6-10-13)24-19(15)22-18(14)23-20/h1-10,14-19H,11H2/t14?,15?,16?,17?,18-,19+,20+,21- |
| InChIKey | LRMYBPYJIYTHFM-VQKZFFILSA-N |
| XLogP | 3.33 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |