About 8,8-dichlorobicyclo[4.2.0]octa-1,3,5-trien-7-one
8,8-dichlorobicyclo[4.2.0]octa-1,3,5-trien-7-one (PubChem CID 13182754) has the molecular formula C8H4Cl2O
and a molecular weight of 187.03 g/mol. Its IUPAC name is 8,8-dichlorobicyclo[4.2.0]octa-1,3,5-trien-7-one.
Molecular Properties
| Compound Name | 8,8-dichlorobicyclo[4.2.0]octa-1,3,5-trien-7-one |
| PubChem CID | 13182754 |
| Molecular Formula | C8H4Cl2O |
| Molecular Weight | 187.03 g/mol |
| Exact Mass | 185.96 |
| IUPAC Name | 8,8-dichlorobicyclo[4.2.0]octa-1,3,5-trien-7-one |
| SMILES | O=C1c2ccccc2C1(Cl)Cl |
| InChI | InChI=1S/C8H4Cl2O/c9-8(10)6-4-2-1-3-5(6)7(8)11/h1-4H |
| InChIKey | BVOWPQMIXZHZGS-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.03 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 8,8-dichlorobicyclo[4.2.0]octa-1,3,5-trien-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8,8-dichlorobicyclo[4.2.0]octa-1,3,5-trien-7-one?
The IUPAC name of 8,8-dichlorobicyclo[4.2.0]octa-1,3,5-trien-7-one (CID 13182754) is 8,8-dichlorobicyclo[4.2.0]octa-1,3,5-trien-7-one.
What is the SMILES notation for 8,8-dichlorobicyclo[4.2.0]octa-1,3,5-trien-7-one?
The canonical SMILES for 8,8-dichlorobicyclo[4.2.0]octa-1,3,5-trien-7-one is O=C1c2ccccc2C1(Cl)Cl.
What is the InChIKey of 8,8-dichlorobicyclo[4.2.0]octa-1,3,5-trien-7-one?
The InChIKey is BVOWPQMIXZHZGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4Cl2O/c9-8(10)6-4-2-1-3-5(6)7(8)11/h1-4H.
What are the key properties of 8,8-dichlorobicyclo[4.2.0]octa-1,3,5-trien-7-one?
8,8-dichlorobicyclo[4.2.0]octa-1,3,5-trien-7-one has a molecular weight of 187.03 g/mol, XLogP of 2.51, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8,8-dichlorobicyclo[4.2.0]octa-1,3,5-trien-7-one is sourced from PubChem (CID 13182754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).