(1R,2R,6R,7S)-5-oxotricyclo[5.2.1.02,6]dec-8-ene-2-carboxylic acid

C11H12O3 — CID 10921361

IUPAC(1R,2R,6R,7S)-5-oxotricyclo[5.2.1.02,6]dec-8-ene-2-carboxylic acid
SMILESO=C1CC[C@]2(C(=O)O)[C@H]1[C@@H]1C=C[C@H]2C1
InChIInChI=1S/C11H12O3/c12-8-3-4-11(10(13)14)7-2-1-6(5-7)9(8)11/h1-2,6-7,9H,3-5H2,(H,13,14)/t6-,7+,9+,11-/m1/s1
InChIKeyXMUBESDJFKRCNW-VFYMIVFZSA-N
MW192.21 g/mol
LogP1.24
Rot. Bonds1

About (1R,2R,6R,7S)-5-oxotricyclo[5.2.1.02,6]dec-8-ene-2-carboxylic acid

(1R,2R,6R,7S)-5-oxotricyclo[5.2.1.02,6]dec-8-ene-2-carboxylic acid (PubChem CID 10921361) has the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. Its IUPAC name is (1R,2R,6R,7S)-5-oxotricyclo[5.2.1.02,6]dec-8-ene-2-carboxylic acid.

Molecular Properties

Compound Name(1R,2R,6R,7S)-5-oxotricyclo[5.2.1.02,6]dec-8-ene-2-carboxylic acid
PubChem CID10921361
Molecular FormulaC11H12O3
Molecular Weight192.21 g/mol
Exact Mass192.08
IUPAC Name(1R,2R,6R,7S)-5-oxotricyclo[5.2.1.02,6]dec-8-ene-2-carboxylic acid
SMILESO=C1CC[C@]2(C(=O)O)[C@H]1[C@@H]1C=C[C@H]2C1
InChIInChI=1S/C11H12O3/c12-8-3-4-11(10(13)14)7-2-1-6(5-7)9(8)11/h1-2,6-7,9H,3-5H2,(H,13,14)/t6-,7+,9+,11-/m1/s1
InChIKeyXMUBESDJFKRCNW-VFYMIVFZSA-N
XLogP1.24
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500192.21
LogP ≤ 51.24
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze (1R,2R,6R,7S)-5-oxotricyclo[5.2.1.02,6]dec-8-ene-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (1R,2R,6R,7S)-5-oxotricyclo[5.2.1.02,6]dec-8-ene-2-carboxylic acid?
The IUPAC name of (1R,2R,6R,7S)-5-oxotricyclo[5.2.1.02,6]dec-8-ene-2-carboxylic acid (CID 10921361) is (1R,2R,6R,7S)-5-oxotricyclo[5.2.1.02,6]dec-8-ene-2-carboxylic acid.
What is the SMILES notation for (1R,2R,6R,7S)-5-oxotricyclo[5.2.1.02,6]dec-8-ene-2-carboxylic acid?
The canonical SMILES for (1R,2R,6R,7S)-5-oxotricyclo[5.2.1.02,6]dec-8-ene-2-carboxylic acid is O=C1CC[C@]2(C(=O)O)[C@H]1[C@@H]1C=C[C@H]2C1.
What is the InChIKey of (1R,2R,6R,7S)-5-oxotricyclo[5.2.1.02,6]dec-8-ene-2-carboxylic acid?
The InChIKey is XMUBESDJFKRCNW-VFYMIVFZSA-N. The full InChI is InChI=1S/C11H12O3/c12-8-3-4-11(10(13)14)7-2-1-6(5-7)9(8)11/h1-2,6-7,9H,3-5H2,(H,13,14)/t6-,7+,9+,11-/m1/s1.
What are the key properties of (1R,2R,6R,7S)-5-oxotricyclo[5.2.1.02,6]dec-8-ene-2-carboxylic acid?
(1R,2R,6R,7S)-5-oxotricyclo[5.2.1.02,6]dec-8-ene-2-carboxylic acid has a molecular weight of 192.21 g/mol, XLogP of 1.24, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,2R,6R,7S)-5-oxotricyclo[5.2.1.02,6]dec-8-ene-2-carboxylic acid is sourced from PubChem (CID 10921361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).