C8H11NO3 — CID 85377571
2-amino-3-hydroxybicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 85377571) has the molecular formula C8H11NO3 and a molecular weight of 169.18 g/mol. Its IUPAC name is 2-amino-3-hydroxybicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
| Compound Name | 2-amino-3-hydroxybicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 85377571 |
| Molecular Formula | C8H11NO3 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | 2-amino-3-hydroxybicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | NC1(C(=O)O)C2C=CC(C2)C1O |
| InChI | InChI=1S/C8H11NO3/c9-8(7(11)12)5-2-1-4(3-5)6(8)10/h1-2,4-6,10H,3,9H2,(H,11,12) |
| InChIKey | MHUPJEZHCXSNAU-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|