C9H9ClO4 — CID 130883146
(1R,2S,3S,4S)-2-chlorobicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid (PubChem CID 130883146) has the molecular formula C9H9ClO4 and a molecular weight of 216.62 g/mol. Its IUPAC name is (1R,2S,3S,4S)-2-chlorobicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid.
| Compound Name | (1R,2S,3S,4S)-2-chlorobicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid |
|---|---|
| PubChem CID | 130883146 |
| Molecular Formula | C9H9ClO4 |
| Molecular Weight | 216.62 g/mol |
| Exact Mass | 216.02 |
| IUPAC Name | (1R,2S,3S,4S)-2-chlorobicyclo[2.2.1]hept-5-ene-2,3-dicarboxylic acid |
| SMILES | O=C(O)[C@@H]1[C@@H]2C=C[C@@H](C2)[C@@]1(Cl)C(=O)O |
| InChI | InChI=1S/C9H9ClO4/c10-9(8(13)14)5-2-1-4(3-5)6(9)7(11)12/h1-2,4-6H,3H2,(H,11,12)(H,13,14)/t4-,5+,6+,9+/m1/s1 |
| InChIKey | REHPIWWQXAJRRI-OLHMAJIHSA-N |
| XLogP | 0.96 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.62 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|