C10H8F6O2 — CID 51411750
(1S,2R,4R)-3,3-bis(trifluoromethyl)bicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 51411750) has the molecular formula C10H8F6O2 and a molecular weight of 274.16 g/mol. Its IUPAC name is (1S,2R,4R)-3,3-bis(trifluoromethyl)bicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
| Compound Name | (1S,2R,4R)-3,3-bis(trifluoromethyl)bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 51411750 |
| Molecular Formula | C10H8F6O2 |
| Molecular Weight | 274.16 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | (1S,2R,4R)-3,3-bis(trifluoromethyl)bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1[C@@H]2C=C[C@@H](C2)C1(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H8F6O2/c11-9(12,13)8(10(14,15)16)5-2-1-4(3-5)6(8)7(17)18/h1-2,4-6H,3H2,(H,17,18)/t4-,5+,6+/m1/s1 |
| InChIKey | UAMJAXATTKYUOP-SRQIZXRXSA-N |
| XLogP | 3.00 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.16 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|