C10H13NO2 — CID 110172348
(2R)-2-(aminomethyl)tricyclo[3.2.1.02,4]oct-6-ene-3-carboxylic acid (PubChem CID 110172348) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is (2R)-2-(aminomethyl)tricyclo[3.2.1.02,4]oct-6-ene-3-carboxylic acid.
| Compound Name | (2R)-2-(aminomethyl)tricyclo[3.2.1.02,4]oct-6-ene-3-carboxylic acid |
|---|---|
| PubChem CID | 110172348 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | (2R)-2-(aminomethyl)tricyclo[3.2.1.02,4]oct-6-ene-3-carboxylic acid |
| SMILES | NC[C@]12C3C=CC(C3)C1C2C(=O)O |
| InChI | InChI=1S/C10H13NO2/c11-4-10-6-2-1-5(3-6)7(10)8(10)9(12)13/h1-2,5-8H,3-4,11H2,(H,12,13)/t5?,6?,7?,8?,10-/m0/s1 |
| InChIKey | IANSTHOIGSGFRF-FFECJYOWSA-N |
| XLogP | 0.47 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|