C13H18O — CID 141120203
2-tetracyclo[6.2.1.13,6.02,7]dodec-4-enylmethanol (PubChem CID 141120203) has the molecular formula C13H18O and a molecular weight of 190.29 g/mol. Its IUPAC name is 2-tetracyclo[6.2.1.13,6.02,7]dodec-4-enylmethanol.
| Compound Name | 2-tetracyclo[6.2.1.13,6.02,7]dodec-4-enylmethanol |
|---|---|
| PubChem CID | 141120203 |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.14 |
| IUPAC Name | 2-tetracyclo[6.2.1.13,6.02,7]dodec-4-enylmethanol |
| SMILES | OCC12C3C=CC(C3)C1C1CCC2C1 |
| InChI | InChI=1S/C13H18O/c14-7-13-10-3-1-8(5-10)12(13)9-2-4-11(13)6-9/h1,3,8-12,14H,2,4-7H2 |
| InChIKey | IXXUBPLWNVVIKI-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|