C20H24O4 — CID 10758670
dimethyl (1S,2R,3S,4S,5S,8R,9R,10R,11S,12R)-hexacyclo[10.2.1.15,8.02,11.03,10.04,9]hexadec-6-ene-3,10-dicarboxylate (PubChem CID 10758670) has the molecular formula C20H24O4 and a molecular weight of 328.41 g/mol. Its IUPAC name is dimethyl (1S,2R,3S,4S,5S,8R,9R,10R,11S,12R)-hexacyclo[10.2.1.15,8.02,11.03,10.04,9]hexadec-6-ene-3,10-dicarboxylate.
| Compound Name | dimethyl (1S,2R,3S,4S,5S,8R,9R,10R,11S,12R)-hexacyclo[10.2.1.15,8.02,11.03,10.04,9]hexadec-6-ene-3,10-dicarboxylate |
|---|---|
| PubChem CID | 10758670 |
| Molecular Formula | C20H24O4 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | dimethyl (1S,2R,3S,4S,5S,8R,9R,10R,11S,12R)-hexacyclo[10.2.1.15,8.02,11.03,10.04,9]hexadec-6-ene-3,10-dicarboxylate |
| SMILES | COC(=O)[C@@]12[C@H]3[C@@H]4CC[C@@H](C4)[C@H]3[C@]1(C(=O)OC)[C@@H]1[C@H]2[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C20H24O4/c1-23-17(21)19-13-9-3-5-11(7-9)15(13)20(19,18(22)24-2)16-12-6-4-10(8-12)14(16)19/h3,5,9-16H,4,6-8H2,1-2H3/t9-,10+,11+,12-,13+,14-,15-,16+,19+,20- |
| InChIKey | SIVIRVZRVAQVNN-HRPYVWAMSA-N |
| XLogP | 2.43 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cycloheptane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|