C16H16O4 — CID 10869421
dimethyl (1S,4S,7R,10R)-pentacyclo[6.4.0.02,10.03,7.04,9]dodeca-5,11-diene-8,9-dicarboxylate (PubChem CID 10869421) has the molecular formula C16H16O4 and a molecular weight of 272.30 g/mol. Its IUPAC name is dimethyl (1S,4S,7R,10R)-pentacyclo[6.4.0.02,10.03,7.04,9]dodeca-5,11-diene-8,9-dicarboxylate.
| Compound Name | dimethyl (1S,4S,7R,10R)-pentacyclo[6.4.0.02,10.03,7.04,9]dodeca-5,11-diene-8,9-dicarboxylate |
|---|---|
| PubChem CID | 10869421 |
| Molecular Formula | C16H16O4 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | dimethyl (1S,4S,7R,10R)-pentacyclo[6.4.0.02,10.03,7.04,9]dodeca-5,11-diene-8,9-dicarboxylate |
| SMILES | COC(=O)C12[C@@H]3C=C[C@H]4C3C3[C@@H](C=C[C@@H]31)C42C(=O)OC |
| InChI | InChI=1S/C16H16O4/c1-19-13(17)15-7-3-5-9-11(7)12-8(15)4-6-10(12)16(9,15)14(18)20-2/h3-12H,1-2H3/t7-,8+,9+,10-,11?,12?,15?,16? |
| InChIKey | CHIWLBJLZHMOAV-OSOSLEPESA-N |
| XLogP | 1.18 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|