C8H7ClO8 — CID 158703393
1-chlorocyclobutane-1,2,3,4-tetracarboxylic acid (PubChem CID 158703393) has the molecular formula C8H7ClO8 and a molecular weight of 266.59 g/mol. Its IUPAC name is 1-chlorocyclobutane-1,2,3,4-tetracarboxylic acid.
| Compound Name | 1-chlorocyclobutane-1,2,3,4-tetracarboxylic acid |
|---|---|
| PubChem CID | 158703393 |
| Molecular Formula | C8H7ClO8 |
| Molecular Weight | 266.59 g/mol |
| Exact Mass | 265.98 |
| IUPAC Name | 1-chlorocyclobutane-1,2,3,4-tetracarboxylic acid |
| SMILES | O=C(O)C1C(C(=O)O)C(Cl)(C(=O)O)C1C(=O)O |
| InChI | InChI=1S/C8H7ClO8/c9-8(7(16)17)2(5(12)13)1(4(10)11)3(8)6(14)15/h1-3H,(H,10,11)(H,12,13)(H,14,15)(H,16,17) |
| InChIKey | IHVBREQNPXXKQE-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.59 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|