C11H14Cl2O2 — CID 51665068
(1S,4R,6R,9S)-10,10-dichlorotricyclo[7.1.0.04,6]decane-5-carboxylic acid (PubChem CID 51665068) has the molecular formula C11H14Cl2O2 and a molecular weight of 249.14 g/mol. Its IUPAC name is (1S,4R,6R,9S)-10,10-dichlorotricyclo[7.1.0.04,6]decane-5-carboxylic acid.
| Compound Name | (1S,4R,6R,9S)-10,10-dichlorotricyclo[7.1.0.04,6]decane-5-carboxylic acid |
|---|---|
| PubChem CID | 51665068 |
| Molecular Formula | C11H14Cl2O2 |
| Molecular Weight | 249.14 g/mol |
| Exact Mass | 248.04 |
| IUPAC Name | (1S,4R,6R,9S)-10,10-dichlorotricyclo[7.1.0.04,6]decane-5-carboxylic acid |
| SMILES | O=C(O)C1[C@@H]2CC[C@H]3[C@H](CC[C@@H]12)C3(Cl)Cl |
| InChI | InChI=1S/C11H14Cl2O2/c12-11(13)7-3-1-5-6(2-4-8(7)11)9(5)10(14)15/h5-9H,1-4H2,(H,14,15)/t5-,6-,7+,8+/m1/s1 |
| InChIKey | KTMXBVDXHDBMDV-NGJRWZKOSA-N |
| XLogP | 2.93 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.14 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|