C17H25Cl2NO — CID 98349175
(1R,4R,6R,9R)-10,10-dichloro-N-cyclohexyltricyclo[7.1.0.04,6]decane-5-carboxamide (PubChem CID 98349175) has the molecular formula C17H25Cl2NO and a molecular weight of 330.30 g/mol. Its IUPAC name is (1R,4R,6R,9R)-10,10-dichloro-N-cyclohexyltricyclo[7.1.0.04,6]decane-5-carboxamide.
| Compound Name | (1R,4R,6R,9R)-10,10-dichloro-N-cyclohexyltricyclo[7.1.0.04,6]decane-5-carboxamide |
|---|---|
| PubChem CID | 98349175 |
| Molecular Formula | C17H25Cl2NO |
| Molecular Weight | 330.30 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | (1R,4R,6R,9R)-10,10-dichloro-N-cyclohexyltricyclo[7.1.0.04,6]decane-5-carboxamide |
| SMILES | O=C(NC1CCCCC1)C1[C@@H]2CC[C@@H]3[C@@H](CC[C@@H]12)C3(Cl)Cl |
| InChI | InChI=1S/C17H25Cl2NO/c18-17(19)13-8-6-11-12(7-9-14(13)17)15(11)16(21)20-10-4-2-1-3-5-10/h10-15H,1-9H2,(H,20,21)/t11-,12-,13-,14-/m1/s1 |
| InChIKey | RGWGQLBFUPUQLE-AAVRWANBSA-N |
| XLogP | 4.29 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.30 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|