C16H22O4 — CID 51412344
(1R,4R,5R,6R,9E,13S,14S)-tricyclo[11.1.0.04,6]tetradec-9-ene-5,14-dicarboxylic acid (PubChem CID 51412344) has the molecular formula C16H22O4 and a molecular weight of 278.35 g/mol. Its IUPAC name is (1R,4R,5R,6R,9E,13S,14S)-tricyclo[11.1.0.04,6]tetradec-9-ene-5,14-dicarboxylic acid.
| Compound Name | (1R,4R,5R,6R,9E,13S,14S)-tricyclo[11.1.0.04,6]tetradec-9-ene-5,14-dicarboxylic acid |
|---|---|
| PubChem CID | 51412344 |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | (1R,4R,5R,6R,9E,13S,14S)-tricyclo[11.1.0.04,6]tetradec-9-ene-5,14-dicarboxylic acid |
| SMILES | O=C(O)[C@@H]1[C@@H]2CC/C=C/CC[C@H]3[C@@H](CC[C@H]21)[C@H]3C(=O)O |
| InChI | InChI=1S/C16H22O4/c17-15(18)13-9-5-3-1-2-4-6-10-12(8-7-11(9)13)14(10)16(19)20/h1-2,9-14H,3-8H2,(H,17,18)(H,19,20)/b2-1+/t9-,10+,11-,12-,13-,14+/m1/s1 |
| InChIKey | HTMLAJKVTFEYLT-VJDFKXAXSA-N |
| XLogP | 2.79 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|