C12H16O4 — CID 134081589
(2S,6S)-tricyclo[4.2.1.12,5]decane-9,10-dicarboxylic acid (PubChem CID 134081589) has the molecular formula C12H16O4 and a molecular weight of 224.26 g/mol. Its IUPAC name is (2S,6S)-tricyclo[4.2.1.12,5]decane-9,10-dicarboxylic acid.
| Compound Name | (2S,6S)-tricyclo[4.2.1.12,5]decane-9,10-dicarboxylic acid |
|---|---|
| PubChem CID | 134081589 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | (2S,6S)-tricyclo[4.2.1.12,5]decane-9,10-dicarboxylic acid |
| SMILES | O=C(O)C1C2CC[C@H]1C1CC[C@@H]2C1C(=O)O |
| InChI | InChI=1S/C12H16O4/c13-11(14)9-5-1-2-6(9)8-4-3-7(5)10(8)12(15)16/h5-10H,1-4H2,(H,13,14)(H,15,16)/t5-,6?,7?,8-,9?,10?/m0/s1 |
| InChIKey | OPIRQTIRXFXKOA-UFAQZEEFSA-N |
| XLogP | 1.45 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |