(2S,6S)-tricyclo[4.2.1.12,5]decane-9,10-dicarboxylic acid

C12H16O4 — CID 134081589

IUPAC(2S,6S)-tricyclo[4.2.1.12,5]decane-9,10-dicarboxylic acid
SMILESO=C(O)C1C2CC[C@H]1C1CC[C@@H]2C1C(=O)O
InChIInChI=1S/C12H16O4/c13-11(14)9-5-1-2-6(9)8-4-3-7(5)10(8)12(15)16/h5-10H,1-4H2,(H,13,14)(H,15,16)/t5-,6?,7?,8-,9?,10?/m0/s1
InChIKeyOPIRQTIRXFXKOA-UFAQZEEFSA-N
MW224.26 g/mol
LogP1.45
Rot. Bonds2

About (2S,6S)-tricyclo[4.2.1.12,5]decane-9,10-dicarboxylic acid

(2S,6S)-tricyclo[4.2.1.12,5]decane-9,10-dicarboxylic acid (PubChem CID 134081589) has the molecular formula C12H16O4 and a molecular weight of 224.26 g/mol. Its IUPAC name is (2S,6S)-tricyclo[4.2.1.12,5]decane-9,10-dicarboxylic acid.

Molecular Properties

Compound Name(2S,6S)-tricyclo[4.2.1.12,5]decane-9,10-dicarboxylic acid
PubChem CID134081589
Molecular FormulaC12H16O4
Molecular Weight224.26 g/mol
Exact Mass224.10
IUPAC Name(2S,6S)-tricyclo[4.2.1.12,5]decane-9,10-dicarboxylic acid
SMILESO=C(O)C1C2CC[C@H]1C1CC[C@@H]2C1C(=O)O
InChIInChI=1S/C12H16O4/c13-11(14)9-5-1-2-6(9)8-4-3-7(5)10(8)12(15)16/h5-10H,1-4H2,(H,13,14)(H,15,16)/t5-,6?,7?,8-,9?,10?/m0/s1
InChIKeyOPIRQTIRXFXKOA-UFAQZEEFSA-N
XLogP1.45
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500224.26
LogP ≤ 51.45
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze (2S,6S)-tricyclo[4.2.1.12,5]decane-9,10-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S,6S)-tricyclo[4.2.1.12,5]decane-9,10-dicarboxylic acid?
The IUPAC name of (2S,6S)-tricyclo[4.2.1.12,5]decane-9,10-dicarboxylic acid (CID 134081589) is (2S,6S)-tricyclo[4.2.1.12,5]decane-9,10-dicarboxylic acid.
What is the SMILES notation for (2S,6S)-tricyclo[4.2.1.12,5]decane-9,10-dicarboxylic acid?
The canonical SMILES for (2S,6S)-tricyclo[4.2.1.12,5]decane-9,10-dicarboxylic acid is O=C(O)C1C2CC[C@H]1C1CC[C@@H]2C1C(=O)O.
What is the InChIKey of (2S,6S)-tricyclo[4.2.1.12,5]decane-9,10-dicarboxylic acid?
The InChIKey is OPIRQTIRXFXKOA-UFAQZEEFSA-N. The full InChI is InChI=1S/C12H16O4/c13-11(14)9-5-1-2-6(9)8-4-3-7(5)10(8)12(15)16/h5-10H,1-4H2,(H,13,14)(H,15,16)/t5-,6?,7?,8-,9?,10?/m0/s1.
What are the key properties of (2S,6S)-tricyclo[4.2.1.12,5]decane-9,10-dicarboxylic acid?
(2S,6S)-tricyclo[4.2.1.12,5]decane-9,10-dicarboxylic acid has a molecular weight of 224.26 g/mol, XLogP of 1.45, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,6S)-tricyclo[4.2.1.12,5]decane-9,10-dicarboxylic acid is sourced from PubChem (CID 134081589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).