C11H16O2 — CID 131113488
(1R,2S,6R,7S)-tricyclo[5.2.1.02,6]decane-10-carboxylic acid (PubChem CID 131113488) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is (1R,2S,6R,7S)-tricyclo[5.2.1.02,6]decane-10-carboxylic acid.
| Compound Name | (1R,2S,6R,7S)-tricyclo[5.2.1.02,6]decane-10-carboxylic acid |
|---|---|
| PubChem CID | 131113488 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | (1R,2S,6R,7S)-tricyclo[5.2.1.02,6]decane-10-carboxylic acid |
| SMILES | O=C(O)C1[C@H]2CC[C@@H]1[C@H]1CCC[C@H]12 |
| InChI | InChI=1S/C11H16O2/c12-11(13)10-8-4-5-9(10)7-3-1-2-6(7)8/h6-10H,1-5H2,(H,12,13)/t6-,7+,8+,9-,10? |
| InChIKey | YCOCZWBKIBDFRV-ZGHGJDBCSA-N |
| XLogP | 2.14 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |