(1R,2S,6R,7S)-tricyclo[5.2.1.02,6]decane-10-carboxylic acid

C11H16O2 — CID 131113488

IUPAC(1R,2S,6R,7S)-tricyclo[5.2.1.02,6]decane-10-carboxylic acid
SMILESO=C(O)C1[C@H]2CC[C@@H]1[C@H]1CCC[C@H]12
InChIInChI=1S/C11H16O2/c12-11(13)10-8-4-5-9(10)7-3-1-2-6(7)8/h6-10H,1-5H2,(H,12,13)/t6-,7+,8+,9-,10?
InChIKeyYCOCZWBKIBDFRV-ZGHGJDBCSA-N
MW180.25 g/mol
LogP2.14
Rot. Bonds1

About (1R,2S,6R,7S)-tricyclo[5.2.1.02,6]decane-10-carboxylic acid

(1R,2S,6R,7S)-tricyclo[5.2.1.02,6]decane-10-carboxylic acid (PubChem CID 131113488) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is (1R,2S,6R,7S)-tricyclo[5.2.1.02,6]decane-10-carboxylic acid.

Molecular Properties

Compound Name(1R,2S,6R,7S)-tricyclo[5.2.1.02,6]decane-10-carboxylic acid
PubChem CID131113488
Molecular FormulaC11H16O2
Molecular Weight180.25 g/mol
Exact Mass180.12
IUPAC Name(1R,2S,6R,7S)-tricyclo[5.2.1.02,6]decane-10-carboxylic acid
SMILESO=C(O)C1[C@H]2CC[C@@H]1[C@H]1CCC[C@H]12
InChIInChI=1S/C11H16O2/c12-11(13)10-8-4-5-9(10)7-3-1-2-6(7)8/h6-10H,1-5H2,(H,12,13)/t6-,7+,8+,9-,10?
InChIKeyYCOCZWBKIBDFRV-ZGHGJDBCSA-N
XLogP2.14
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500180.25
LogP ≤ 52.14
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze (1R,2S,6R,7S)-tricyclo[5.2.1.02,6]decane-10-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (1R,2S,6R,7S)-tricyclo[5.2.1.02,6]decane-10-carboxylic acid?
The IUPAC name of (1R,2S,6R,7S)-tricyclo[5.2.1.02,6]decane-10-carboxylic acid (CID 131113488) is (1R,2S,6R,7S)-tricyclo[5.2.1.02,6]decane-10-carboxylic acid.
What is the SMILES notation for (1R,2S,6R,7S)-tricyclo[5.2.1.02,6]decane-10-carboxylic acid?
The canonical SMILES for (1R,2S,6R,7S)-tricyclo[5.2.1.02,6]decane-10-carboxylic acid is O=C(O)C1[C@H]2CC[C@@H]1[C@H]1CCC[C@H]12.
What is the InChIKey of (1R,2S,6R,7S)-tricyclo[5.2.1.02,6]decane-10-carboxylic acid?
The InChIKey is YCOCZWBKIBDFRV-ZGHGJDBCSA-N. The full InChI is InChI=1S/C11H16O2/c12-11(13)10-8-4-5-9(10)7-3-1-2-6(7)8/h6-10H,1-5H2,(H,12,13)/t6-,7+,8+,9-,10?.
What are the key properties of (1R,2S,6R,7S)-tricyclo[5.2.1.02,6]decane-10-carboxylic acid?
(1R,2S,6R,7S)-tricyclo[5.2.1.02,6]decane-10-carboxylic acid has a molecular weight of 180.25 g/mol, XLogP of 2.14, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,2S,6R,7S)-tricyclo[5.2.1.02,6]decane-10-carboxylic acid is sourced from PubChem (CID 131113488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).