C6H8O2 — CID 55300069
(1R,4S)-bicyclo[2.1.0]pentane-5-carboxylic acid (PubChem CID 55300069) has the molecular formula C6H8O2 and a molecular weight of 112.13 g/mol. Its IUPAC name is (1R,4S)-bicyclo[2.1.0]pentane-5-carboxylic acid.
| Compound Name | (1R,4S)-bicyclo[2.1.0]pentane-5-carboxylic acid |
|---|---|
| PubChem CID | 55300069 |
| Molecular Formula | C6H8O2 |
| Molecular Weight | 112.13 g/mol |
| Exact Mass | 112.05 |
| IUPAC Name | (1R,4S)-bicyclo[2.1.0]pentane-5-carboxylic acid |
| SMILES | O=C(O)C1[C@H]2CC[C@@H]12 |
| InChI | InChI=1S/C6H8O2/c7-6(8)5-3-1-2-4(3)5/h3-5H,1-2H2,(H,7,8)/t3-,4+,5? |
| InChIKey | LGOIBBWJYJOSHI-NGQZWQHPSA-N |
| XLogP | 0.73 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 112.13 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |