C13H18O6 — CID 57215846
1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1,2,4-tricarboxylic acid (PubChem CID 57215846) has the molecular formula C13H18O6 and a molecular weight of 270.28 g/mol. Its IUPAC name is 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1,2,4-tricarboxylic acid.
| Compound Name | 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1,2,4-tricarboxylic acid |
|---|---|
| PubChem CID | 57215846 |
| Molecular Formula | C13H18O6 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1,2,4-tricarboxylic acid |
| SMILES | O=C(O)C1CC(C(=O)O)C(C(=O)O)C2CCCCC12 |
| InChI | InChI=1S/C13H18O6/c14-11(15)8-5-9(12(16)17)10(13(18)19)7-4-2-1-3-6(7)8/h6-10H,1-5H2,(H,14,15)(H,16,17)(H,18,19) |
| InChIKey | MWIRHRRVXSNJKP-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |