C10H12O7 — CID 158943945
4-(1-hydroxyethenyl)cyclopentane-1,2,3-tricarboxylic acid (PubChem CID 158943945) has the molecular formula C10H12O7 and a molecular weight of 244.20 g/mol. Its IUPAC name is 4-(1-hydroxyethenyl)cyclopentane-1,2,3-tricarboxylic acid.
| Compound Name | 4-(1-hydroxyethenyl)cyclopentane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 158943945 |
| Molecular Formula | C10H12O7 |
| Molecular Weight | 244.20 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | 4-(1-hydroxyethenyl)cyclopentane-1,2,3-tricarboxylic acid |
| SMILES | C=C(O)C1CC(C(=O)O)C(C(=O)O)C1C(=O)O |
| InChI | InChI=1S/C10H12O7/c1-3(11)4-2-5(8(12)13)7(10(16)17)6(4)9(14)15/h4-7,11H,1-2H2,(H,12,13)(H,14,15)(H,16,17) |
| InChIKey | WJJOVVCXUHZUEE-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.20 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|