C23H33O17+ — CID 158133592
cyclopentane-1,2,3,4-tetracarboxylic acid;hydron;methanol;tetramethyl cyclopentane-1,2,3,4-tetracarboxylate (PubChem CID 158133592) has the molecular formula C23H33O17+ and a molecular weight of 581.50 g/mol. Its IUPAC name is cyclopentane-1,2,3,4-tetracarboxylic acid;hydron;methanol;tetramethyl cyclopentane-1,2,3,4-tetracarboxylate.
| Compound Name | cyclopentane-1,2,3,4-tetracarboxylic acid;hydron;methanol;tetramethyl cyclopentane-1,2,3,4-tetracarboxylate |
|---|---|
| PubChem CID | 158133592 |
| Molecular Formula | C23H33O17+ |
| Molecular Weight | 581.50 g/mol |
| Exact Mass | 581.17 |
| IUPAC Name | cyclopentane-1,2,3,4-tetracarboxylic acid;hydron;methanol;tetramethyl cyclopentane-1,2,3,4-tetracarboxylate |
| SMILES | CO.COC(=O)C1CC(C(=O)OC)C(C(=O)OC)C1C(=O)OC.O=C(O)C1CC(C(=O)O)C(C(=O)O)C1C(=O)O.[H+] |
| InChI | InChI=1S/C13H18O8.C9H10O8.CH4O/c1-18-10(14)6-5-7(11(15)19-2)9(13(17)21-4)8(6)12(16)20-3;10-6(11)2-1-3(7(12)13)5(9(16)17)4(2)8(14)15;1-2/h6-9H,5H2,1-4H3;2-5H,1H2,(H,10,11)(H,12,13)(H,14,15)(H,16,17);2H,1H3/p+1 |
| InChIKey | FTBNZUGTBNORQH-UHFFFAOYSA-O |
| XLogP | -1.54 |
| TPSA | 274.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.50 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|