trans-(1R,2R)-cyclopentane-1,2,3,4-tetracarboxylic acid

C9H10O8 — CID 54441949

IUPACtrans-(1R,2R)-cyclopentane-1,2,3,4-tetracarboxylic acid
SMILESO=C(O)C1C[C@@H](C(=O)O)[C@@H](C(=O)O)C1C(=O)O
InChIInChI=1S/C9H10O8/c10-6(11)2-1-3(7(12)13)5(9(16)17)4(2)8(14)15/h2-5H,1H2,(H,10,11)(H,12,13)(H,14,15)(H,16,17)/t2-,3?,4-,5?/m1/s1
InChIKeyWOSVXXBNNCUXMT-WRIDMXSSSA-N
MW246.17 g/mol
LogP-0.81
Rot. Bonds4

About trans-(1R,2R)-cyclopentane-1,2,3,4-tetracarboxylic acid

trans-(1R,2R)-cyclopentane-1,2,3,4-tetracarboxylic acid (PubChem CID 54441949) has the molecular formula C9H10O8 and a molecular weight of 246.17 g/mol. Its IUPAC name is trans-(1R,2R)-cyclopentane-1,2,3,4-tetracarboxylic acid.

Molecular Properties

Compound Nametrans-(1R,2R)-cyclopentane-1,2,3,4-tetracarboxylic acid
PubChem CID54441949
Molecular FormulaC9H10O8
Molecular Weight246.17 g/mol
Exact Mass246.04
IUPAC Nametrans-(1R,2R)-cyclopentane-1,2,3,4-tetracarboxylic acid
SMILESO=C(O)C1C[C@@H](C(=O)O)[C@@H](C(=O)O)C1C(=O)O
InChIInChI=1S/C9H10O8/c10-6(11)2-1-3(7(12)13)5(9(16)17)4(2)8(14)15/h2-5H,1H2,(H,10,11)(H,12,13)(H,14,15)(H,16,17)/t2-,3?,4-,5?/m1/s1
InChIKeyWOSVXXBNNCUXMT-WRIDMXSSSA-N
XLogP-0.81
TPSA149.20 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500246.17
LogP ≤ 5-0.81
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Analyze trans-(1R,2R)-cyclopentane-1,2,3,4-tetracarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of trans-(1R,2R)-cyclopentane-1,2,3,4-tetracarboxylic acid?
The IUPAC name of trans-(1R,2R)-cyclopentane-1,2,3,4-tetracarboxylic acid (CID 54441949) is trans-(1R,2R)-cyclopentane-1,2,3,4-tetracarboxylic acid.
What is the SMILES notation for trans-(1R,2R)-cyclopentane-1,2,3,4-tetracarboxylic acid?
The canonical SMILES for trans-(1R,2R)-cyclopentane-1,2,3,4-tetracarboxylic acid is O=C(O)C1C[C@@H](C(=O)O)[C@@H](C(=O)O)C1C(=O)O.
What is the InChIKey of trans-(1R,2R)-cyclopentane-1,2,3,4-tetracarboxylic acid?
The InChIKey is WOSVXXBNNCUXMT-WRIDMXSSSA-N. The full InChI is InChI=1S/C9H10O8/c10-6(11)2-1-3(7(12)13)5(9(16)17)4(2)8(14)15/h2-5H,1H2,(H,10,11)(H,12,13)(H,14,15)(H,16,17)/t2-,3?,4-,5?/m1/s1.
What are the key properties of trans-(1R,2R)-cyclopentane-1,2,3,4-tetracarboxylic acid?
trans-(1R,2R)-cyclopentane-1,2,3,4-tetracarboxylic acid has a molecular weight of 246.17 g/mol, XLogP of -0.81, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1R,2R)-cyclopentane-1,2,3,4-tetracarboxylic acid is sourced from PubChem (CID 54441949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).