C10H12O8 — CID 99934066
(1R,2R,3R,4S)-3-(carboxymethyl)cyclopentane-1,2,4-tricarboxylic acid (PubChem CID 99934066) has the molecular formula C10H12O8 and a molecular weight of 260.20 g/mol. Its IUPAC name is (1R,2R,3R,4S)-3-(carboxymethyl)cyclopentane-1,2,4-tricarboxylic acid.
| Compound Name | (1R,2R,3R,4S)-3-(carboxymethyl)cyclopentane-1,2,4-tricarboxylic acid |
|---|---|
| PubChem CID | 99934066 |
| Molecular Formula | C10H12O8 |
| Molecular Weight | 260.20 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | (1R,2R,3R,4S)-3-(carboxymethyl)cyclopentane-1,2,4-tricarboxylic acid |
| SMILES | O=C(O)C[C@H]1[C@@H](C(=O)O)[C@H](C(=O)O)C[C@@H]1C(=O)O |
| InChI | InChI=1S/C10H12O8/c11-6(12)2-3-4(8(13)14)1-5(9(15)16)7(3)10(17)18/h3-5,7H,1-2H2,(H,11,12)(H,13,14)(H,15,16)(H,17,18)/t3-,4+,5-,7-/m1/s1 |
| InChIKey | RHRNYXVSZLSRRP-LPWFLVPJSA-N |
| XLogP | -0.42 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.20 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |