C16H20O4 — CID 98164914
2-[(1R,3R,5R,7S)-6-(carboxymethyl)-2-pentacyclo[5.4.1.03,10.05,9.08,11]dodecanyl]acetic acid (PubChem CID 98164914) has the molecular formula C16H20O4 and a molecular weight of 276.33 g/mol. Its IUPAC name is 2-[(1R,3R,5R,7S)-6-(carboxymethyl)-2-pentacyclo[5.4.1.03,10.05,9.08,11]dodecanyl]acetic acid.
| Compound Name | 2-[(1R,3R,5R,7S)-6-(carboxymethyl)-2-pentacyclo[5.4.1.03,10.05,9.08,11]dodecanyl]acetic acid |
|---|---|
| PubChem CID | 98164914 |
| Molecular Formula | C16H20O4 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 2-[(1R,3R,5R,7S)-6-(carboxymethyl)-2-pentacyclo[5.4.1.03,10.05,9.08,11]dodecanyl]acetic acid |
| SMILES | O=C(O)CC1[C@@H]2C[C@H]3C4C2C2C4[C@H](C[C@@H]21)C3CC(=O)O |
| InChI | InChI=1S/C16H20O4/c17-11(18)3-5-7-1-8-6(4-12(19)20)10-2-9(5)15-13(7)14(8)16(10)15/h5-10,13-16H,1-4H2,(H,17,18)(H,19,20)/t5?,6?,7-,8-,9-,10+,13?,14?,15?,16?/m1/s1 |
| InChIKey | LYTPPZLDGPSXGB-CRIVVUOPSA-N |
| XLogP | 1.95 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |