C20H24O4 — CID 124780057
2-[(2R,3R,4R,6S,7R,9S,10R,11S,14S,16S)-9-(carboxymethyl)-4-hexacyclo[8.5.1.02,6.03,14.07,16.011,15]hexadec-12-enyl]acetic acid (PubChem CID 124780057) has the molecular formula C20H24O4 and a molecular weight of 328.41 g/mol. Its IUPAC name is 2-[(2R,3R,4R,6S,7R,9S,10R,11S,14S,16S)-9-(carboxymethyl)-4-hexacyclo[8.5.1.02,6.03,14.07,16.011,15]hexadec-12-enyl]acetic acid.
| Compound Name | 2-[(2R,3R,4R,6S,7R,9S,10R,11S,14S,16S)-9-(carboxymethyl)-4-hexacyclo[8.5.1.02,6.03,14.07,16.011,15]hexadec-12-enyl]acetic acid |
|---|---|
| PubChem CID | 124780057 |
| Molecular Formula | C20H24O4 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | 2-[(2R,3R,4R,6S,7R,9S,10R,11S,14S,16S)-9-(carboxymethyl)-4-hexacyclo[8.5.1.02,6.03,14.07,16.011,15]hexadec-12-enyl]acetic acid |
| SMILES | O=C(O)C[C@H]1C[C@H]2[C@H]3C[C@@H](CC(=O)O)[C@H]4[C@H]3C3C5[C@@H](C=C[C@H]54)[C@@H]1[C@H]32 |
| InChI | InChI=1S/C20H24O4/c21-13(22)5-7-3-11-12-4-8(6-14(23)24)16-10-2-1-9-15(7)18(11)20(17(9)10)19(12)16/h1-2,7-12,15-20H,3-6H2,(H,21,22)(H,23,24)/t7-,8+,9-,10-,11+,12-,15+,16+,17?,18-,19+,20?/m0/s1 |
| InChIKey | CSFXZVCEJJRBRM-AVXCLORQSA-N |
| XLogP | 2.75 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|