C18H24N2O6 — CID 22899644
2-(carboxymethyl)-4-[(4-methylanilino)methoxy]-3-(methylcarbamoyl)cyclopentane-1-carboxylic acid (PubChem CID 22899644) has the molecular formula C18H24N2O6 and a molecular weight of 364.40 g/mol. Its IUPAC name is 2-(carboxymethyl)-4-[(4-methylanilino)methoxy]-3-(methylcarbamoyl)cyclopentane-1-carboxylic acid.
| Compound Name | 2-(carboxymethyl)-4-[(4-methylanilino)methoxy]-3-(methylcarbamoyl)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 22899644 |
| Molecular Formula | C18H24N2O6 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | 2-(carboxymethyl)-4-[(4-methylanilino)methoxy]-3-(methylcarbamoyl)cyclopentane-1-carboxylic acid |
| SMILES | CNC(=O)C1C(OCNc2ccc(C)cc2)CC(C(=O)O)C1CC(=O)O |
| InChI | InChI=1S/C18H24N2O6/c1-10-3-5-11(6-4-10)20-9-26-14-7-13(18(24)25)12(8-15(21)22)16(14)17(23)19-2/h3-6,12-14,16,20H,7-9H2,1-2H3,(H,19,23)(H,21,22)(H,24,25) |
| InChIKey | WMJTUXORRJQRDC-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|