C14H12O8 — CID 139715001
1-phenylcyclobutane-1,2,3,4-tetracarboxylic acid (PubChem CID 139715001) has the molecular formula C14H12O8 and a molecular weight of 308.24 g/mol. Its IUPAC name is 1-phenylcyclobutane-1,2,3,4-tetracarboxylic acid.
| Compound Name | 1-phenylcyclobutane-1,2,3,4-tetracarboxylic acid |
|---|---|
| PubChem CID | 139715001 |
| Molecular Formula | C14H12O8 |
| Molecular Weight | 308.24 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | 1-phenylcyclobutane-1,2,3,4-tetracarboxylic acid |
| SMILES | O=C(O)C1C(C(=O)O)C(C(=O)O)(c2ccccc2)C1C(=O)O |
| InChI | InChI=1S/C14H12O8/c15-10(16)7-8(11(17)18)14(13(21)22,9(7)12(19)20)6-4-2-1-3-5-6/h1-5,7-9H,(H,15,16)(H,17,18)(H,19,20)(H,21,22) |
| InChIKey | LWYOOCABVRDGHY-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.24 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |