C22H16NO8-3 — CID 9499880
(2R,3S,5R,6R)-1,4-diphenyl-7-azoniabicyclo[2.2.1]heptane-2,3,5,6-tetracarboxylate (PubChem CID 9499880) has the molecular formula C22H16NO8-3 and a molecular weight of 422.37 g/mol. Its IUPAC name is (2R,3S,5R,6R)-1,4-diphenyl-7-azoniabicyclo[2.2.1]heptane-2,3,5,6-tetracarboxylate.
| Compound Name | (2R,3S,5R,6R)-1,4-diphenyl-7-azoniabicyclo[2.2.1]heptane-2,3,5,6-tetracarboxylate |
|---|---|
| PubChem CID | 9499880 |
| Molecular Formula | C22H16NO8-3 |
| Molecular Weight | 422.37 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | (2R,3S,5R,6R)-1,4-diphenyl-7-azoniabicyclo[2.2.1]heptane-2,3,5,6-tetracarboxylate |
| SMILES | O=C([O-])[C@@H]1[C@@H](C(=O)[O-])C2(c3ccccc3)[NH2+]C1(c1ccccc1)[C@H](C(=O)[O-])[C@@H]2C(=O)[O-] |
| InChI | InChI=1S/C22H19NO8/c24-17(25)13-15(19(28)29)22(12-9-5-2-6-10-12)16(20(30)31)14(18(26)27)21(13,23-22)11-7-3-1-4-8-11/h1-10,13-16,23H,(H,24,25)(H,26,27)(H,28,29)(H,30,31)/p-3/t13-,14-,15-,16+,21?,22?/m0/s1 |
| InChIKey | SLHKTTWYLPUJLM-DQOGKMHCSA-K |
| XLogP | -5.17 |
| TPSA | 177.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.37 |
| LogP ≤ 5 | -5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |