C15H15NO4 — CID 10754708
(1R,2S,3R,4S)-2-benzamido-3-hydroxybicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 10754708) has the molecular formula C15H15NO4 and a molecular weight of 273.29 g/mol. Its IUPAC name is (1R,2S,3R,4S)-2-benzamido-3-hydroxybicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
| Compound Name | (1R,2S,3R,4S)-2-benzamido-3-hydroxybicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 10754708 |
| Molecular Formula | C15H15NO4 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | (1R,2S,3R,4S)-2-benzamido-3-hydroxybicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | O=C(N[C@]1(C(=O)O)[C@H](O)[C@@H]2C=C[C@H]1C2)c1ccccc1 |
| InChI | InChI=1S/C15H15NO4/c17-12-10-6-7-11(8-10)15(12,14(19)20)16-13(18)9-4-2-1-3-5-9/h1-7,10-12,17H,8H2,(H,16,18)(H,19,20)/t10-,11+,12-,15+/m1/s1 |
| InChIKey | WMRFERIFGHNGNP-ZAZJYDDPSA-N |
| XLogP | 0.81 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|