C22H21NO3 — CID 10736424
methyl (1R,2S,3S,4S)-2-benzamido-3-phenylbicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 10736424) has the molecular formula C22H21NO3 and a molecular weight of 347.41 g/mol. Its IUPAC name is methyl (1R,2S,3S,4S)-2-benzamido-3-phenylbicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | methyl (1R,2S,3S,4S)-2-benzamido-3-phenylbicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 10736424 |
| Molecular Formula | C22H21NO3 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | methyl (1R,2S,3S,4S)-2-benzamido-3-phenylbicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | COC(=O)[C@@]1(NC(=O)c2ccccc2)[C@H](c2ccccc2)[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C22H21NO3/c1-26-21(25)22(23-20(24)16-10-6-3-7-11-16)18-13-12-17(14-18)19(22)15-8-4-2-5-9-15/h2-13,17-19H,14H2,1H3,(H,23,24)/t17-,18+,19-,22+/m1/s1 |
| InChIKey | WMKGFXJQCRFSPS-MOXWOTFGSA-N |
| XLogP | 3.32 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|