C36H34N2O6 — CID 164673236
dimethyl 1,2-dibenzamido-3,4-bis(3-methylphenyl)cyclobutane-1,2-dicarboxylate (PubChem CID 164673236) has the molecular formula C36H34N2O6 and a molecular weight of 590.68 g/mol. Its IUPAC name is dimethyl 1,2-dibenzamido-3,4-bis(3-methylphenyl)cyclobutane-1,2-dicarboxylate.
| Compound Name | dimethyl 1,2-dibenzamido-3,4-bis(3-methylphenyl)cyclobutane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 164673236 |
| Molecular Formula | C36H34N2O6 |
| Molecular Weight | 590.68 g/mol |
| Exact Mass | 590.24 |
| IUPAC Name | dimethyl 1,2-dibenzamido-3,4-bis(3-methylphenyl)cyclobutane-1,2-dicarboxylate |
| SMILES | COC(=O)C1(NC(=O)c2ccccc2)C(c2cccc(C)c2)C(c2cccc(C)c2)C1(NC(=O)c1ccccc1)C(=O)OC |
| InChI | InChI=1S/C36H34N2O6/c1-23-13-11-19-27(21-23)29-30(28-20-12-14-24(2)22-28)36(34(42)44-4,38-32(40)26-17-9-6-10-18-26)35(29,33(41)43-3)37-31(39)25-15-7-5-8-16-25/h5-22,29-30H,1-4H3,(H,37,39)(H,38,40) |
| InChIKey | XNGROZXEJAKMSI-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.68 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |