C20H17NO3 — CID 86749167
[(1S,2R,3S,4R)-2-nitro-3-phenyl-2-bicyclo[2.2.1]hept-5-enyl]-phenylmethanone (PubChem CID 86749167) has the molecular formula C20H17NO3 and a molecular weight of 319.36 g/mol. Its IUPAC name is [(1S,2R,3S,4R)-2-nitro-3-phenyl-2-bicyclo[2.2.1]hept-5-enyl]-phenylmethanone.
| Compound Name | [(1S,2R,3S,4R)-2-nitro-3-phenyl-2-bicyclo[2.2.1]hept-5-enyl]-phenylmethanone |
|---|---|
| PubChem CID | 86749167 |
| Molecular Formula | C20H17NO3 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | [(1S,2R,3S,4R)-2-nitro-3-phenyl-2-bicyclo[2.2.1]hept-5-enyl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)[C@@]1([N+](=O)[O-])[C@@H]2C=C[C@@H](C2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C20H17NO3/c22-19(15-9-5-2-6-10-15)20(21(23)24)17-12-11-16(13-17)18(20)14-7-3-1-4-8-14/h1-12,16-18H,13H2/t16-,17+,18+,20+/m0/s1 |
| InChIKey | OHPXXRXMAWHROR-JRBPQWBISA-N |
| XLogP | 3.87 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|