C25H28O2S — CID 102154734
ethyl (1S,2R,3R,4R)-3-phenyl-2-(3-phenylsulfanylpropyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 102154734) has the molecular formula C25H28O2S and a molecular weight of 392.56 g/mol. Its IUPAC name is ethyl (1S,2R,3R,4R)-3-phenyl-2-(3-phenylsulfanylpropyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | ethyl (1S,2R,3R,4R)-3-phenyl-2-(3-phenylsulfanylpropyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 102154734 |
| Molecular Formula | C25H28O2S |
| Molecular Weight | 392.56 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | ethyl (1S,2R,3R,4R)-3-phenyl-2-(3-phenylsulfanylpropyl)bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | CCOC(=O)[C@]1(CCCSc2ccccc2)[C@@H]2C=C[C@@H](C2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C25H28O2S/c1-2-27-24(26)25(16-9-17-28-22-12-7-4-8-13-22)21-15-14-20(18-21)23(25)19-10-5-3-6-11-19/h3-8,10-15,20-21,23H,2,9,16-18H2,1H3/t20-,21+,23-,25+/m0/s1 |
| InChIKey | GAOFVYJPJDCUFT-PLRSXRBSSA-N |
| XLogP | 6.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.56 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|