C23H29NO2S — CID 18722877
methyl 1-methyl-2-phenyl-3-(3-phenylsulfanylpropyl)piperidine-3-carboxylate (PubChem CID 18722877) has the molecular formula C23H29NO2S and a molecular weight of 383.56 g/mol. Its IUPAC name is methyl 1-methyl-2-phenyl-3-(3-phenylsulfanylpropyl)piperidine-3-carboxylate.
| Compound Name | methyl 1-methyl-2-phenyl-3-(3-phenylsulfanylpropyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 18722877 |
| Molecular Formula | C23H29NO2S |
| Molecular Weight | 383.56 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | methyl 1-methyl-2-phenyl-3-(3-phenylsulfanylpropyl)piperidine-3-carboxylate |
| SMILES | COC(=O)C1(CCCSc2ccccc2)CCCN(C)C1c1ccccc1 |
| InChI | InChI=1S/C23H29NO2S/c1-24-17-9-15-23(22(25)26-2,21(24)19-11-5-3-6-12-19)16-10-18-27-20-13-7-4-8-14-20/h3-8,11-14,21H,9-10,15-18H2,1-2H3 |
| InChIKey | PYUGMCUKBKPPOE-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.56 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|